C11H20N2O4S — CID 146388757
tert-butyl 3-[ethenyl(methyl)sulfamoyl]azetidine-1-carboxylate (PubChem CID 146388757) has the molecular formula C11H20N2O4S and a molecular weight of 276.36 g/mol. Its IUPAC name is tert-butyl 3-[ethenyl(methyl)sulfamoyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[ethenyl(methyl)sulfamoyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 146388757 |
| Molecular Formula | C11H20N2O4S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | tert-butyl 3-[ethenyl(methyl)sulfamoyl]azetidine-1-carboxylate |
| SMILES | C=CN(C)S(=O)(=O)C1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C11H20N2O4S/c1-6-12(5)18(15,16)9-7-13(8-9)10(14)17-11(2,3)4/h6,9H,1,7-8H2,2-5H3 |
| InChIKey | TVRPUWCDABKVJR-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |