C11H16F3NO5S — CID 168877214
tert-butyl 5-methyl-4-(trifluoromethylsulfonyloxy)-2,3-dihydropyrrole-1-carboxylate (PubChem CID 168877214) has the molecular formula C11H16F3NO5S and a molecular weight of 331.31 g/mol. Its IUPAC name is tert-butyl 5-methyl-4-(trifluoromethylsulfonyloxy)-2,3-dihydropyrrole-1-carboxylate.
| Compound Name | tert-butyl 5-methyl-4-(trifluoromethylsulfonyloxy)-2,3-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 168877214 |
| Molecular Formula | C11H16F3NO5S |
| Molecular Weight | 331.31 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | tert-butyl 5-methyl-4-(trifluoromethylsulfonyloxy)-2,3-dihydropyrrole-1-carboxylate |
| SMILES | CC1=C(OS(=O)(=O)C(F)(F)F)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H16F3NO5S/c1-7-8(20-21(17,18)11(12,13)14)5-6-15(7)9(16)19-10(2,3)4/h5-6H2,1-4H3 |
| InChIKey | DVOSENIOUYGHNY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|