C25H37F3N2O12S — CID 160960484
1-O-tert-butyl 3-O-methyl 4-oxopiperidine-1,3-dicarboxylate;1-O-tert-butyl 5-O-methyl 4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate (PubChem CID 160960484) has the molecular formula C25H37F3N2O12S and a molecular weight of 646.63 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-methyl 4-oxopiperidine-1,3-dicarboxylate;1-O-tert-butyl 5-O-methyl 4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-methyl 4-oxopiperidine-1,3-dicarboxylate;1-O-tert-butyl 5-O-methyl 4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate |
|---|---|
| PubChem CID | 160960484 |
| Molecular Formula | C25H37F3N2O12S |
| Molecular Weight | 646.63 g/mol |
| Exact Mass | 646.20 |
| IUPAC Name | 1-O-tert-butyl 3-O-methyl 4-oxopiperidine-1,3-dicarboxylate;1-O-tert-butyl 5-O-methyl 4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate |
| SMILES | COC(=O)C1=C(OS(=O)(=O)C(F)(F)F)CCN(C(=O)OC(C)(C)C)C1.COC(=O)C1CN(C(=O)OC(C)(C)C)CCC1=O |
| InChI | InChI=1S/C13H18F3NO7S.C12H19NO5/c1-12(2,3)23-11(19)17-6-5-9(8(7-17)10(18)22-4)24-25(20,21)13(14,15)16;1-12(2,3)18-11(16)13-6-5-9(14)8(7-13)10(15)17-4/h5-7H2,1-4H3;8H,5-7H2,1-4H3 |
| InChIKey | SWYGOELYOSOIQK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 172.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.63 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|