C10H12F3NO7S — CID 87606546
5-ethoxycarbonyl-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1-carboxylic acid (PubChem CID 87606546) has the molecular formula C10H12F3NO7S and a molecular weight of 347.27 g/mol. Its IUPAC name is 5-ethoxycarbonyl-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1-carboxylic acid.
| Compound Name | 5-ethoxycarbonyl-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1-carboxylic acid |
|---|---|
| PubChem CID | 87606546 |
| Molecular Formula | C10H12F3NO7S |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 5-ethoxycarbonyl-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1-carboxylic acid |
| SMILES | CCOC(=O)C1=C(OS(=O)(=O)C(F)(F)F)CCN(C(=O)O)C1 |
| InChI | InChI=1S/C10H12F3NO7S/c1-2-20-8(15)6-5-14(9(16)17)4-3-7(6)21-22(18,19)10(11,12)13/h2-5H2,1H3,(H,16,17) |
| InChIKey | QYBNKDDKHYWXND-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|