C10H12F3NO7S — CID 91184670
5,5-dimethyl-4-(trifluoromethylsulfonyloxy)-2,6-dihydropyridine-1,3-dicarboxylic acid (PubChem CID 91184670) has the molecular formula C10H12F3NO7S and a molecular weight of 347.27 g/mol. Its IUPAC name is 5,5-dimethyl-4-(trifluoromethylsulfonyloxy)-2,6-dihydropyridine-1,3-dicarboxylic acid.
| Compound Name | 5,5-dimethyl-4-(trifluoromethylsulfonyloxy)-2,6-dihydropyridine-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 91184670 |
| Molecular Formula | C10H12F3NO7S |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 5,5-dimethyl-4-(trifluoromethylsulfonyloxy)-2,6-dihydropyridine-1,3-dicarboxylic acid |
| SMILES | CC1(C)CN(C(=O)O)CC(C(=O)O)=C1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H12F3NO7S/c1-9(2)4-14(8(17)18)3-5(7(15)16)6(9)21-22(19,20)10(11,12)13/h3-4H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | BRQHTMBFJNQSNB-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|