C8H8F3NO7S — CID 123935283
5-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1,4-dicarboxylic acid (PubChem CID 123935283) has the molecular formula C8H8F3NO7S and a molecular weight of 319.21 g/mol. Its IUPAC name is 5-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1,4-dicarboxylic acid.
| Compound Name | 5-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 123935283 |
| Molecular Formula | C8H8F3NO7S |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | 5-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1,4-dicarboxylic acid |
| SMILES | O=C(O)C1=C(OS(=O)(=O)C(F)(F)F)CN(C(=O)O)CC1 |
| InChI | InChI=1S/C8H8F3NO7S/c9-8(10,11)20(17,18)19-5-3-12(7(15)16)2-1-4(5)6(13)14/h1-3H2,(H,13,14)(H,15,16) |
| InChIKey | CEPYBYDXLPQPAH-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|