C13H13NO4 — CID 91432306
5-phenyl-3,6-dihydro-2H-pyridine-1,4-dicarboxylic acid (PubChem CID 91432306) has the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. Its IUPAC name is 5-phenyl-3,6-dihydro-2H-pyridine-1,4-dicarboxylic acid.
| Compound Name | 5-phenyl-3,6-dihydro-2H-pyridine-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 91432306 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 5-phenyl-3,6-dihydro-2H-pyridine-1,4-dicarboxylic acid |
| SMILES | O=C(O)C1=C(c2ccccc2)CN(C(=O)O)CC1 |
| InChI | InChI=1S/C13H13NO4/c15-12(16)10-6-7-14(13(17)18)8-11(10)9-4-2-1-3-5-9/h1-5H,6-8H2,(H,15,16)(H,17,18) |
| InChIKey | LNVRHLPLKWYHAN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |