C11H13NO2 — CID 175983212
8-methyl-3,4-dihydro-1H-isoquinoline-2-carboxylic acid (PubChem CID 175983212) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 8-methyl-3,4-dihydro-1H-isoquinoline-2-carboxylic acid.
| Compound Name | 8-methyl-3,4-dihydro-1H-isoquinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 175983212 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 8-methyl-3,4-dihydro-1H-isoquinoline-2-carboxylic acid |
| SMILES | Cc1cccc2c1CN(C(=O)O)CC2 |
| InChI | InChI=1S/C11H13NO2/c1-8-3-2-4-9-5-6-12(11(13)14)7-10(8)9/h2-4H,5-7H2,1H3,(H,13,14) |
| InChIKey | CBNDUHCHQYPDOV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |