C13H19NO2S — CID 58777927
8-methyl-2-propan-2-ylsulfonyl-3,4-dihydro-1H-isoquinoline (PubChem CID 58777927) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is 8-methyl-2-propan-2-ylsulfonyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 8-methyl-2-propan-2-ylsulfonyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 58777927 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 8-methyl-2-propan-2-ylsulfonyl-3,4-dihydro-1H-isoquinoline |
| SMILES | Cc1cccc2c1CN(S(=O)(=O)C(C)C)CC2 |
| InChI | InChI=1S/C13H19NO2S/c1-10(2)17(15,16)14-8-7-12-6-4-5-11(3)13(12)9-14/h4-6,10H,7-9H2,1-3H3 |
| InChIKey | BJDRTRFYMLFFGK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |