About 4-(4-methylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylic acid
4-(4-methylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylic acid (PubChem CID 141365416) has the molecular formula C14H15NO4
and a molecular weight of 261.28 g/mol. Its IUPAC name is 4-(4-methylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylic acid.
Molecular Properties
| Compound Name | 4-(4-methylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylic acid |
| PubChem CID | 141365416 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 4-(4-methylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylic acid |
| SMILES | Cc1ccc(C2=C(C(=O)O)CN(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C14H15NO4/c1-9-2-4-10(5-3-9)11-6-7-15(14(18)19)8-12(11)13(16)17/h2-5H,6-8H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | LXYOABDVLKXXTL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(4-methylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylic acid?
The IUPAC name of 4-(4-methylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylic acid (CID 141365416) is 4-(4-methylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylic acid.
What is the SMILES notation for 4-(4-methylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylic acid?
The canonical SMILES for 4-(4-methylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylic acid is Cc1ccc(C2=C(C(=O)O)CN(C(=O)O)CC2)cc1.
What is the InChIKey of 4-(4-methylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylic acid?
The InChIKey is LXYOABDVLKXXTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO4/c1-9-2-4-10(5-3-9)11-6-7-15(14(18)19)8-12(11)13(16)17/h2-5H,6-8H2,1H3,(H,16,17)(H,18,19).
What are the key properties of 4-(4-methylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylic acid?
4-(4-methylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylic acid has a molecular weight of 261.28 g/mol, XLogP of 2.22, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methylphenyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylic acid is sourced from PubChem (CID 141365416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).