About 2,4,6,7-tetrahydropyrrolo[3,4-c]pyridine-5-carboxylic acid
2,4,6,7-tetrahydropyrrolo[3,4-c]pyridine-5-carboxylic acid (PubChem CID 68725346) has the molecular formula C8H10N2O2
and a molecular weight of 166.18 g/mol. Its IUPAC name is 2,4,6,7-tetrahydropyrrolo[3,4-c]pyridine-5-carboxylic acid.
Analyze 2,4,6,7-tetrahydropyrrolo[3,4-c]pyridine-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,6,7-tetrahydropyrrolo[3,4-c]pyridine-5-carboxylic acid?
The IUPAC name of 2,4,6,7-tetrahydropyrrolo[3,4-c]pyridine-5-carboxylic acid (CID 68725346) is 2,4,6,7-tetrahydropyrrolo[3,4-c]pyridine-5-carboxylic acid.
What is the SMILES notation for 2,4,6,7-tetrahydropyrrolo[3,4-c]pyridine-5-carboxylic acid?
The canonical SMILES for 2,4,6,7-tetrahydropyrrolo[3,4-c]pyridine-5-carboxylic acid is O=C(O)N1CCc2c[nH]cc2C1.
What is the InChIKey of 2,4,6,7-tetrahydropyrrolo[3,4-c]pyridine-5-carboxylic acid?
The InChIKey is MSROAKPMMNYOHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2/c11-8(12)10-2-1-6-3-9-4-7(6)5-10/h3-4,9H,1-2,5H2,(H,11,12).
What are the key properties of 2,4,6,7-tetrahydropyrrolo[3,4-c]pyridine-5-carboxylic acid?
2,4,6,7-tetrahydropyrrolo[3,4-c]pyridine-5-carboxylic acid has a molecular weight of 166.18 g/mol, XLogP of 1.05, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,6,7-tetrahydropyrrolo[3,4-c]pyridine-5-carboxylic acid is sourced from PubChem (CID 68725346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).