C10H10N2O4 — CID 155143574
3,4-dihydro-1H-2,6-naphthyridine-2,7-dicarboxylic acid (PubChem CID 155143574) has the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. Its IUPAC name is 3,4-dihydro-1H-2,6-naphthyridine-2,7-dicarboxylic acid.
| Compound Name | 3,4-dihydro-1H-2,6-naphthyridine-2,7-dicarboxylic acid |
|---|---|
| PubChem CID | 155143574 |
| Molecular Formula | C10H10N2O4 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 3,4-dihydro-1H-2,6-naphthyridine-2,7-dicarboxylic acid |
| SMILES | O=C(O)c1cc2c(cn1)CCN(C(=O)O)C2 |
| InChI | InChI=1S/C10H10N2O4/c13-9(14)8-3-7-5-12(10(15)16)2-1-6(7)4-11-8/h3-4H,1-2,5H2,(H,13,14)(H,15,16) |
| InChIKey | NJFWKBBHUXHUKS-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |