3-amino-6,8-dihydro-5H-1,7-naphthyridine-7-carboxylic acid

C9H11N3O2 — CID 175443625

IUPAC3-amino-6,8-dihydro-5H-1,7-naphthyridine-7-carboxylic acid
SMILESNc1cnc2c(c1)CCN(C(=O)O)C2
InChIInChI=1S/C9H11N3O2/c10-7-3-6-1-2-12(9(13)14)5-8(6)11-4-7/h3-4H,1-2,5,10H2,(H,13,14)
InChIKeyJRKRROWITGTSBV-UHFFFAOYSA-N
MW193.21 g/mol
LogP0.70
Rot. Bonds

About 3-amino-6,8-dihydro-5H-1,7-naphthyridine-7-carboxylic acid

3-amino-6,8-dihydro-5H-1,7-naphthyridine-7-carboxylic acid (PubChem CID 175443625) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is 3-amino-6,8-dihydro-5H-1,7-naphthyridine-7-carboxylic acid.

Molecular Properties

Compound Name3-amino-6,8-dihydro-5H-1,7-naphthyridine-7-carboxylic acid
PubChem CID175443625
Molecular FormulaC9H11N3O2
Molecular Weight193.21 g/mol
Exact Mass193.09
IUPAC Name3-amino-6,8-dihydro-5H-1,7-naphthyridine-7-carboxylic acid
SMILESNc1cnc2c(c1)CCN(C(=O)O)C2
InChIInChI=1S/C9H11N3O2/c10-7-3-6-1-2-12(9(13)14)5-8(6)11-4-7/h3-4H,1-2,5,10H2,(H,13,14)
InChIKeyJRKRROWITGTSBV-UHFFFAOYSA-N
XLogP0.70
TPSA79.45 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500193.21
LogP ≤ 50.70
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-amino-6,8-dihydro-5H-1,7-naphthyridine-7-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-amino-6,8-dihydro-5H-1,7-naphthyridine-7-carboxylic acid?
The IUPAC name of 3-amino-6,8-dihydro-5H-1,7-naphthyridine-7-carboxylic acid (CID 175443625) is 3-amino-6,8-dihydro-5H-1,7-naphthyridine-7-carboxylic acid.
What is the SMILES notation for 3-amino-6,8-dihydro-5H-1,7-naphthyridine-7-carboxylic acid?
The canonical SMILES for 3-amino-6,8-dihydro-5H-1,7-naphthyridine-7-carboxylic acid is Nc1cnc2c(c1)CCN(C(=O)O)C2.
What is the InChIKey of 3-amino-6,8-dihydro-5H-1,7-naphthyridine-7-carboxylic acid?
The InChIKey is JRKRROWITGTSBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O2/c10-7-3-6-1-2-12(9(13)14)5-8(6)11-4-7/h3-4H,1-2,5,10H2,(H,13,14).
What are the key properties of 3-amino-6,8-dihydro-5H-1,7-naphthyridine-7-carboxylic acid?
3-amino-6,8-dihydro-5H-1,7-naphthyridine-7-carboxylic acid has a molecular weight of 193.21 g/mol, XLogP of 0.70, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-6,8-dihydro-5H-1,7-naphthyridine-7-carboxylic acid is sourced from PubChem (CID 175443625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).