About 6-amino-3,4-dihydro-1H-2,7-naphthyridine-2-carboxylic acid
6-amino-3,4-dihydro-1H-2,7-naphthyridine-2-carboxylic acid (PubChem CID 70299304) has the molecular formula C9H11N3O2
and a molecular weight of 193.21 g/mol. Its IUPAC name is 6-amino-3,4-dihydro-1H-2,7-naphthyridine-2-carboxylic acid.
Analyze 6-amino-3,4-dihydro-1H-2,7-naphthyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-3,4-dihydro-1H-2,7-naphthyridine-2-carboxylic acid?
The IUPAC name of 6-amino-3,4-dihydro-1H-2,7-naphthyridine-2-carboxylic acid (CID 70299304) is 6-amino-3,4-dihydro-1H-2,7-naphthyridine-2-carboxylic acid.
What is the SMILES notation for 6-amino-3,4-dihydro-1H-2,7-naphthyridine-2-carboxylic acid?
The canonical SMILES for 6-amino-3,4-dihydro-1H-2,7-naphthyridine-2-carboxylic acid is Nc1cc2c(cn1)CN(C(=O)O)CC2.
What is the InChIKey of 6-amino-3,4-dihydro-1H-2,7-naphthyridine-2-carboxylic acid?
The InChIKey is IADGTAACHJZTLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O2/c10-8-3-6-1-2-12(9(13)14)5-7(6)4-11-8/h3-4H,1-2,5H2,(H2,10,11)(H,13,14).
What are the key properties of 6-amino-3,4-dihydro-1H-2,7-naphthyridine-2-carboxylic acid?
6-amino-3,4-dihydro-1H-2,7-naphthyridine-2-carboxylic acid has a molecular weight of 193.21 g/mol, XLogP of 0.70, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-3,4-dihydro-1H-2,7-naphthyridine-2-carboxylic acid is sourced from PubChem (CID 70299304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).