6-oxo-1,3,4,7-tetrahydro-2,7-naphthyridine-2-carboxylic acid

C9H10N2O3 — CID 69401533

IUPAC6-oxo-1,3,4,7-tetrahydro-2,7-naphthyridine-2-carboxylic acid
SMILESO=C(O)N1CCc2cc(=O)[nH]cc2C1
InChIInChI=1S/C9H10N2O3/c12-8-3-6-1-2-11(9(13)14)5-7(6)4-10-8/h3-4H,1-2,5H2,(H,10,12)(H,13,14)
InChIKeyNRRPBZSTRBUZLQ-UHFFFAOYSA-N
MW194.19 g/mol
LogP0.41
Rot. Bonds

About 6-oxo-1,3,4,7-tetrahydro-2,7-naphthyridine-2-carboxylic acid

6-oxo-1,3,4,7-tetrahydro-2,7-naphthyridine-2-carboxylic acid (PubChem CID 69401533) has the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. Its IUPAC name is 6-oxo-1,3,4,7-tetrahydro-2,7-naphthyridine-2-carboxylic acid.

Molecular Properties

Compound Name6-oxo-1,3,4,7-tetrahydro-2,7-naphthyridine-2-carboxylic acid
PubChem CID69401533
Molecular FormulaC9H10N2O3
Molecular Weight194.19 g/mol
Exact Mass194.07
IUPAC Name6-oxo-1,3,4,7-tetrahydro-2,7-naphthyridine-2-carboxylic acid
SMILESO=C(O)N1CCc2cc(=O)[nH]cc2C1
InChIInChI=1S/C9H10N2O3/c12-8-3-6-1-2-11(9(13)14)5-7(6)4-10-8/h3-4H,1-2,5H2,(H,10,12)(H,13,14)
InChIKeyNRRPBZSTRBUZLQ-UHFFFAOYSA-N
XLogP0.41
TPSA73.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.19
LogP ≤ 50.41
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 6-oxo-1,3,4,7-tetrahydro-2,7-naphthyridine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-oxo-1,3,4,7-tetrahydro-2,7-naphthyridine-2-carboxylic acid?
The IUPAC name of 6-oxo-1,3,4,7-tetrahydro-2,7-naphthyridine-2-carboxylic acid (CID 69401533) is 6-oxo-1,3,4,7-tetrahydro-2,7-naphthyridine-2-carboxylic acid.
What is the SMILES notation for 6-oxo-1,3,4,7-tetrahydro-2,7-naphthyridine-2-carboxylic acid?
The canonical SMILES for 6-oxo-1,3,4,7-tetrahydro-2,7-naphthyridine-2-carboxylic acid is O=C(O)N1CCc2cc(=O)[nH]cc2C1.
What is the InChIKey of 6-oxo-1,3,4,7-tetrahydro-2,7-naphthyridine-2-carboxylic acid?
The InChIKey is NRRPBZSTRBUZLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O3/c12-8-3-6-1-2-11(9(13)14)5-7(6)4-10-8/h3-4H,1-2,5H2,(H,10,12)(H,13,14).
What are the key properties of 6-oxo-1,3,4,7-tetrahydro-2,7-naphthyridine-2-carboxylic acid?
6-oxo-1,3,4,7-tetrahydro-2,7-naphthyridine-2-carboxylic acid has a molecular weight of 194.19 g/mol, XLogP of 0.41, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxo-1,3,4,7-tetrahydro-2,7-naphthyridine-2-carboxylic acid is sourced from PubChem (CID 69401533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).