C8H11F4NO5S — CID 170164780
4-fluoro-4-(trifluoromethylsulfonyloxymethyl)piperidine-1-carboxylic acid (PubChem CID 170164780) has the molecular formula C8H11F4NO5S and a molecular weight of 309.24 g/mol. Its IUPAC name is 4-fluoro-4-(trifluoromethylsulfonyloxymethyl)piperidine-1-carboxylic acid.
| Compound Name | 4-fluoro-4-(trifluoromethylsulfonyloxymethyl)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 170164780 |
| Molecular Formula | C8H11F4NO5S |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | 4-fluoro-4-(trifluoromethylsulfonyloxymethyl)piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(F)(COS(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C8H11F4NO5S/c9-7(1-3-13(4-2-7)6(14)15)5-18-19(16,17)8(10,11)12/h1-5H2,(H,14,15) |
| InChIKey | FHXVRVQUGGXWBH-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|