C24H40F3NO5S — CID 143445806
tert-butyl 4-methyl-4-[4-methyl-2-(trifluoromethylsulfonyloxymethyl)phenyl]piperidine-1-carboxylate;ethane (PubChem CID 143445806) has the molecular formula C24H40F3NO5S and a molecular weight of 511.65 g/mol. Its IUPAC name is tert-butyl 4-methyl-4-[4-methyl-2-(trifluoromethylsulfonyloxymethyl)phenyl]piperidine-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-methyl-4-[4-methyl-2-(trifluoromethylsulfonyloxymethyl)phenyl]piperidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 143445806 |
| Molecular Formula | C24H40F3NO5S |
| Molecular Weight | 511.65 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | tert-butyl 4-methyl-4-[4-methyl-2-(trifluoromethylsulfonyloxymethyl)phenyl]piperidine-1-carboxylate;ethane |
| SMILES | CC.CC.Cc1ccc(C2(C)CCN(C(=O)OC(C)(C)C)CC2)c(COS(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C20H28F3NO5S.2C2H6/c1-14-6-7-16(15(12-14)13-28-30(26,27)20(21,22)23)19(5)8-10-24(11-9-19)17(25)29-18(2,3)4;2*1-2/h6-7,12H,8-11,13H2,1-5H3;2*1-2H3 |
| InChIKey | NNJOZLOXNXIGRW-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.65 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|