C20H28F3NO6S — CID 130271598
tert-butyl (3R,4S)-4-(4-methoxyphenyl)-3-methyl-3-(trifluoromethylsulfonyloxymethyl)piperidine-1-carboxylate (PubChem CID 130271598) has the molecular formula C20H28F3NO6S and a molecular weight of 467.51 g/mol. Its IUPAC name is tert-butyl (3R,4S)-4-(4-methoxyphenyl)-3-methyl-3-(trifluoromethylsulfonyloxymethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4S)-4-(4-methoxyphenyl)-3-methyl-3-(trifluoromethylsulfonyloxymethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 130271598 |
| Molecular Formula | C20H28F3NO6S |
| Molecular Weight | 467.51 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | tert-butyl (3R,4S)-4-(4-methoxyphenyl)-3-methyl-3-(trifluoromethylsulfonyloxymethyl)piperidine-1-carboxylate |
| SMILES | COc1ccc([C@@H]2CCN(C(=O)OC(C)(C)C)C[C@]2(C)COS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H28F3NO6S/c1-18(2,3)30-17(25)24-11-10-16(14-6-8-15(28-5)9-7-14)19(4,12-24)13-29-31(26,27)20(21,22)23/h6-9,16H,10-13H2,1-5H3/t16-,19+/m0/s1 |
| InChIKey | QVCMPVVCPZFYSW-QFBILLFUSA-N |
| XLogP | 4.29 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|