C26H34FNO5S — CID 18794731
tert-butyl 4-fluoro-4-[3-(4-methylphenyl)sulfonyloxy-1-phenylpropyl]piperidine-1-carboxylate (PubChem CID 18794731) has the molecular formula C26H34FNO5S and a molecular weight of 491.63 g/mol. Its IUPAC name is tert-butyl 4-fluoro-4-[3-(4-methylphenyl)sulfonyloxy-1-phenylpropyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-fluoro-4-[3-(4-methylphenyl)sulfonyloxy-1-phenylpropyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 18794731 |
| Molecular Formula | C26H34FNO5S |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | tert-butyl 4-fluoro-4-[3-(4-methylphenyl)sulfonyloxy-1-phenylpropyl]piperidine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)OCCC(c2ccccc2)C2(F)CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C26H34FNO5S/c1-20-10-12-22(13-11-20)34(30,31)32-19-14-23(21-8-6-5-7-9-21)26(27)15-17-28(18-16-26)24(29)33-25(2,3)4/h5-13,23H,14-19H2,1-4H3 |
| InChIKey | UWUJGYCJSJGVOJ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|