C25H30N2O6S — CID 86660255
tert-butyl (4Z)-4-(4-methylphenyl)sulfonyloxyiminospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate (PubChem CID 86660255) has the molecular formula C25H30N2O6S and a molecular weight of 486.59 g/mol. Its IUPAC name is tert-butyl (4Z)-4-(4-methylphenyl)sulfonyloxyiminospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl (4Z)-4-(4-methylphenyl)sulfonyloxyiminospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 86660255 |
| Molecular Formula | C25H30N2O6S |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | tert-butyl (4Z)-4-(4-methylphenyl)sulfonyloxyiminospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)O/N=C2/CC3(CCN(C(=O)OC(C)(C)C)CC3)Oc3ccccc32)cc1 |
| InChI | InChI=1S/C25H30N2O6S/c1-18-9-11-19(12-10-18)34(29,30)33-26-21-17-25(31-22-8-6-5-7-20(21)22)13-15-27(16-14-25)23(28)32-24(2,3)4/h5-12H,13-17H2,1-4H3/b26-21- |
| InChIKey | MAACOIDMFSIOFR-QLYXXIJNSA-N |
| XLogP | 4.66 |
| TPSA | 94.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|