About 4-(4-methylphenyl)sulfonyloxyiminospiro[3H-chromene-2,4'-piperidine]-1'-carboxylic acid
4-(4-methylphenyl)sulfonyloxyiminospiro[3H-chromene-2,4'-piperidine]-1'-carboxylic acid (PubChem CID 87410394) has the molecular formula C21H22N2O6S
and a molecular weight of 430.48 g/mol. Its IUPAC name is 4-(4-methylphenyl)sulfonyloxyiminospiro[3H-chromene-2,4'-piperidine]-1'-carboxylic acid.
Molecular Properties
| Compound Name | 4-(4-methylphenyl)sulfonyloxyiminospiro[3H-chromene-2,4'-piperidine]-1'-carboxylic acid |
| PubChem CID | 87410394 |
| Molecular Formula | C21H22N2O6S |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 4-(4-methylphenyl)sulfonyloxyiminospiro[3H-chromene-2,4'-piperidine]-1'-carboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)ON=C2CC3(CCN(C(=O)O)CC3)Oc3ccccc32)cc1 |
| InChI | InChI=1S/C21H22N2O6S/c1-15-6-8-16(9-7-15)30(26,27)29-22-18-14-21(10-12-23(13-11-21)20(24)25)28-19-5-3-2-4-17(18)19/h2-9H,10-14H2,1H3,(H,24,25) |
| InChIKey | MPAVQYFVLGRLRN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 105.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-methylphenyl)sulfonyloxyiminospiro[3H-chromene-2,4'-piperidine]-1'-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methylphenyl)sulfonyloxyiminospiro[3H-chromene-2,4'-piperidine]-1'-carboxylic acid?
The IUPAC name of 4-(4-methylphenyl)sulfonyloxyiminospiro[3H-chromene-2,4'-piperidine]-1'-carboxylic acid (CID 87410394) is 4-(4-methylphenyl)sulfonyloxyiminospiro[3H-chromene-2,4'-piperidine]-1'-carboxylic acid.
What is the SMILES notation for 4-(4-methylphenyl)sulfonyloxyiminospiro[3H-chromene-2,4'-piperidine]-1'-carboxylic acid?
The canonical SMILES for 4-(4-methylphenyl)sulfonyloxyiminospiro[3H-chromene-2,4'-piperidine]-1'-carboxylic acid is Cc1ccc(S(=O)(=O)ON=C2CC3(CCN(C(=O)O)CC3)Oc3ccccc32)cc1.
What is the InChIKey of 4-(4-methylphenyl)sulfonyloxyiminospiro[3H-chromene-2,4'-piperidine]-1'-carboxylic acid?
The InChIKey is MPAVQYFVLGRLRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O6S/c1-15-6-8-16(9-7-15)30(26,27)29-22-18-14-21(10-12-23(13-11-21)20(24)25)28-19-5-3-2-4-17(18)19/h2-9H,10-14H2,1H3,(H,24,25).
What are the key properties of 4-(4-methylphenyl)sulfonyloxyiminospiro[3H-chromene-2,4'-piperidine]-1'-carboxylic acid?
4-(4-methylphenyl)sulfonyloxyiminospiro[3H-chromene-2,4'-piperidine]-1'-carboxylic acid has a molecular weight of 430.48 g/mol, XLogP of 3.40, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methylphenyl)sulfonyloxyiminospiro[3H-chromene-2,4'-piperidine]-1'-carboxylic acid is sourced from PubChem (CID 87410394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).