C7H10N2O5 — CID 91435243
4-(methoxyamino)-2,5-dihydropyrrole-1,3-dicarboxylic acid (PubChem CID 91435243) has the molecular formula C7H10N2O5 and a molecular weight of 202.17 g/mol. Its IUPAC name is 4-(methoxyamino)-2,5-dihydropyrrole-1,3-dicarboxylic acid.
| Compound Name | 4-(methoxyamino)-2,5-dihydropyrrole-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 91435243 |
| Molecular Formula | C7H10N2O5 |
| Molecular Weight | 202.17 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 4-(methoxyamino)-2,5-dihydropyrrole-1,3-dicarboxylic acid |
| SMILES | CONC1=C(C(=O)O)CN(C(=O)O)C1 |
| InChI | InChI=1S/C7H10N2O5/c1-14-8-5-3-9(7(12)13)2-4(5)6(10)11/h8H,2-3H2,1H3,(H,10,11)(H,12,13) |
| InChIKey | WOJXZKNAQONIPK-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.17 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|