C23H27F3O9S — CID 159275978
ethyl 5-phenyl-3,6-dihydro-2H-pyran-4-carboxylate;ethyl 5-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyran-4-carboxylate (PubChem CID 159275978) has the molecular formula C23H27F3O9S and a molecular weight of 536.52 g/mol. Its IUPAC name is ethyl 5-phenyl-3,6-dihydro-2H-pyran-4-carboxylate;ethyl 5-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyran-4-carboxylate.
| Compound Name | ethyl 5-phenyl-3,6-dihydro-2H-pyran-4-carboxylate;ethyl 5-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyran-4-carboxylate |
|---|---|
| PubChem CID | 159275978 |
| Molecular Formula | C23H27F3O9S |
| Molecular Weight | 536.52 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | ethyl 5-phenyl-3,6-dihydro-2H-pyran-4-carboxylate;ethyl 5-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyran-4-carboxylate |
| SMILES | CCOC(=O)C1=C(OS(=O)(=O)C(F)(F)F)COCC1.CCOC(=O)C1=C(c2ccccc2)COCC1 |
| InChI | InChI=1S/C14H16O3.C9H11F3O6S/c1-2-17-14(15)12-8-9-16-10-13(12)11-6-4-3-5-7-11;1-2-17-8(13)6-3-4-16-5-7(6)18-19(14,15)9(10,11)12/h3-7H,2,8-10H2,1H3;2-5H2,1H3 |
| InChIKey | KYHVBZVBZUISTO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.52 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|