C8H12O3S — CID 22026123
ethyl 5-sulfanyl-3,6-dihydro-2H-pyran-4-carboxylate (PubChem CID 22026123) has the molecular formula C8H12O3S and a molecular weight of 188.25 g/mol. Its IUPAC name is ethyl 5-sulfanyl-3,6-dihydro-2H-pyran-4-carboxylate.
| Compound Name | ethyl 5-sulfanyl-3,6-dihydro-2H-pyran-4-carboxylate |
|---|---|
| PubChem CID | 22026123 |
| Molecular Formula | C8H12O3S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | ethyl 5-sulfanyl-3,6-dihydro-2H-pyran-4-carboxylate |
| SMILES | CCOC(=O)C1=C(S)COCC1 |
| InChI | InChI=1S/C8H12O3S/c1-2-11-8(9)6-3-4-10-5-7(6)12/h12H,2-5H2,1H3 |
| InChIKey | WXISKUCQSLZUPY-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|