C19H23F9O15S3 — CID 157300950
ethyl 3-oxooxane-4-carboxylate;ethyl 5-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyran-4-carboxylate;trifluoromethylsulfonyl trifluoromethanesulfonate (PubChem CID 157300950) has the molecular formula C19H23F9O15S3 and a molecular weight of 758.56 g/mol. Its IUPAC name is ethyl 3-oxooxane-4-carboxylate;ethyl 5-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyran-4-carboxylate;trifluoromethylsulfonyl trifluoromethanesulfonate.
| Compound Name | ethyl 3-oxooxane-4-carboxylate;ethyl 5-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyran-4-carboxylate;trifluoromethylsulfonyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 157300950 |
| Molecular Formula | C19H23F9O15S3 |
| Molecular Weight | 758.56 g/mol |
| Exact Mass | 758.01 |
| IUPAC Name | ethyl 3-oxooxane-4-carboxylate;ethyl 5-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyran-4-carboxylate;trifluoromethylsulfonyl trifluoromethanesulfonate |
| SMILES | CCOC(=O)C1=C(OS(=O)(=O)C(F)(F)F)COCC1.CCOC(=O)C1CCOCC1=O.O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H11F3O6S.C8H12O4.C2F6O5S2/c1-2-17-8(13)6-3-4-16-5-7(6)18-19(14,15)9(10,11)12;1-2-12-8(10)6-3-4-11-5-7(6)9;3-1(4,5)14(9,10)13-15(11,12)2(6,7)8/h2-5H2,1H3;6H,2-5H2,1H3; |
| InChIKey | BBWVHFQAFVUDCN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 209.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.56 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|