C24H33F3O11S — CID 160878373
ethyl 8-oxo-1-oxaspiro[4.5]decane-7-carboxylate;ethyl 7-(trifluoromethylsulfonyloxy)-1,4-dioxaspiro[4.5]dec-7-ene-8-carboxylate (PubChem CID 160878373) has the molecular formula C24H33F3O11S and a molecular weight of 586.58 g/mol. Its IUPAC name is ethyl 8-oxo-1-oxaspiro[4.5]decane-7-carboxylate;ethyl 7-(trifluoromethylsulfonyloxy)-1,4-dioxaspiro[4.5]dec-7-ene-8-carboxylate.
| Compound Name | ethyl 8-oxo-1-oxaspiro[4.5]decane-7-carboxylate;ethyl 7-(trifluoromethylsulfonyloxy)-1,4-dioxaspiro[4.5]dec-7-ene-8-carboxylate |
|---|---|
| PubChem CID | 160878373 |
| Molecular Formula | C24H33F3O11S |
| Molecular Weight | 586.58 g/mol |
| Exact Mass | 586.17 |
| IUPAC Name | ethyl 8-oxo-1-oxaspiro[4.5]decane-7-carboxylate;ethyl 7-(trifluoromethylsulfonyloxy)-1,4-dioxaspiro[4.5]dec-7-ene-8-carboxylate |
| SMILES | CCOC(=O)C1=C(OS(=O)(=O)C(F)(F)F)CC2(CC1)OCCO2.CCOC(=O)C1CC2(CCCO2)CCC1=O |
| InChI | InChI=1S/C12H15F3O7S.C12H18O4/c1-2-19-10(16)8-3-4-11(20-5-6-21-11)7-9(8)22-23(17,18)12(13,14)15;1-2-15-11(14)9-8-12(5-3-7-16-12)6-4-10(9)13/h2-7H2,1H3;9H,2-8H2,1H3 |
| InChIKey | SMRWMBWOFJBUQK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.58 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|