C11H15F3O7S — CID 175827229
ethyl (2R)-2-(methoxymethyl)-2-methyl-4-(trifluoromethylsulfonyloxy)-3H-furan-5-carboxylate (PubChem CID 175827229) has the molecular formula C11H15F3O7S and a molecular weight of 348.30 g/mol. Its IUPAC name is ethyl (2R)-2-(methoxymethyl)-2-methyl-4-(trifluoromethylsulfonyloxy)-3H-furan-5-carboxylate.
| Compound Name | ethyl (2R)-2-(methoxymethyl)-2-methyl-4-(trifluoromethylsulfonyloxy)-3H-furan-5-carboxylate |
|---|---|
| PubChem CID | 175827229 |
| Molecular Formula | C11H15F3O7S |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | ethyl (2R)-2-(methoxymethyl)-2-methyl-4-(trifluoromethylsulfonyloxy)-3H-furan-5-carboxylate |
| SMILES | CCOC(=O)C1=C(OS(=O)(=O)C(F)(F)F)C[C@](C)(COC)O1 |
| InChI | InChI=1S/C11H15F3O7S/c1-4-19-9(15)8-7(5-10(2,20-8)6-18-3)21-22(16,17)11(12,13)14/h4-6H2,1-3H3/t10-/m1/s1 |
| InChIKey | LLVFWMYYPVSQPZ-SNVBAGLBSA-N |
| XLogP | 1.45 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|