C11H12F6O6S — CID 175537772
ethyl (2R)-2,3-dimethyl-2-(trifluoromethyl)-4-(trifluoromethylsulfonyloxy)-3H-furan-5-carboxylate (PubChem CID 175537772) has the molecular formula C11H12F6O6S and a molecular weight of 386.27 g/mol. Its IUPAC name is ethyl (2R)-2,3-dimethyl-2-(trifluoromethyl)-4-(trifluoromethylsulfonyloxy)-3H-furan-5-carboxylate.
| Compound Name | ethyl (2R)-2,3-dimethyl-2-(trifluoromethyl)-4-(trifluoromethylsulfonyloxy)-3H-furan-5-carboxylate |
|---|---|
| PubChem CID | 175537772 |
| Molecular Formula | C11H12F6O6S |
| Molecular Weight | 386.27 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | ethyl (2R)-2,3-dimethyl-2-(trifluoromethyl)-4-(trifluoromethylsulfonyloxy)-3H-furan-5-carboxylate |
| SMILES | CCOC(=O)C1=C(OS(=O)(=O)C(F)(F)F)C(C)[C@](C)(C(F)(F)F)O1 |
| InChI | InChI=1S/C11H12F6O6S/c1-4-21-8(18)7-6(23-24(19,20)11(15,16)17)5(2)9(3,22-7)10(12,13)14/h5H,4H2,1-3H3/t5?,9-/m1/s1 |
| InChIKey | BDPKIUMRBMCKGY-OLAZFDQMSA-N |
| XLogP | 2.61 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|