C15H14BrF3O6S — CID 166069622
ethyl 8-bromo-2,2-dimethyl-4-(trifluoromethylsulfonyloxy)chromene-3-carboxylate (PubChem CID 166069622) has the molecular formula C15H14BrF3O6S and a molecular weight of 459.24 g/mol. Its IUPAC name is ethyl 8-bromo-2,2-dimethyl-4-(trifluoromethylsulfonyloxy)chromene-3-carboxylate.
| Compound Name | ethyl 8-bromo-2,2-dimethyl-4-(trifluoromethylsulfonyloxy)chromene-3-carboxylate |
|---|---|
| PubChem CID | 166069622 |
| Molecular Formula | C15H14BrF3O6S |
| Molecular Weight | 459.24 g/mol |
| Exact Mass | 457.96 |
| IUPAC Name | ethyl 8-bromo-2,2-dimethyl-4-(trifluoromethylsulfonyloxy)chromene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(OS(=O)(=O)C(F)(F)F)c2cccc(Br)c2OC1(C)C |
| InChI | InChI=1S/C15H14BrF3O6S/c1-4-23-13(20)10-12(25-26(21,22)15(17,18)19)8-6-5-7-9(16)11(8)24-14(10,2)3/h5-7H,4H2,1-3H3 |
| InChIKey | FGJBUSKVFUTUKH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.24 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|