About [(3S)-5-ethoxycarbonyl-2,2,3-trimethyl-3H-furan-4-yl]boronic acid
[(3S)-5-ethoxycarbonyl-2,2,3-trimethyl-3H-furan-4-yl]boronic acid (PubChem CID 174151581) has the molecular formula C10H17BO5
and a molecular weight of 228.05 g/mol. Its IUPAC name is [(3S)-5-ethoxycarbonyl-2,2,3-trimethyl-3H-furan-4-yl]boronic acid.
Molecular Properties
| Compound Name | [(3S)-5-ethoxycarbonyl-2,2,3-trimethyl-3H-furan-4-yl]boronic acid |
| PubChem CID | 174151581 |
| Molecular Formula | C10H17BO5 |
| Molecular Weight | 228.05 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | [(3S)-5-ethoxycarbonyl-2,2,3-trimethyl-3H-furan-4-yl]boronic acid |
| SMILES | CCOC(=O)C1=C(B(O)O)[C@H](C)C(C)(C)O1 |
| InChI | InChI=1S/C10H17BO5/c1-5-15-9(12)8-7(11(13)14)6(2)10(3,4)16-8/h6,13-14H,5H2,1-4H3/t6-/m0/s1 |
| InChIKey | GFYUXDSXTJCHFZ-LURJTMIESA-N |
| XLogP | 0.26 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.05 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(3S)-5-ethoxycarbonyl-2,2,3-trimethyl-3H-furan-4-yl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-5-ethoxycarbonyl-2,2,3-trimethyl-3H-furan-4-yl]boronic acid?
The IUPAC name of [(3S)-5-ethoxycarbonyl-2,2,3-trimethyl-3H-furan-4-yl]boronic acid (CID 174151581) is [(3S)-5-ethoxycarbonyl-2,2,3-trimethyl-3H-furan-4-yl]boronic acid.
What is the SMILES notation for [(3S)-5-ethoxycarbonyl-2,2,3-trimethyl-3H-furan-4-yl]boronic acid?
The canonical SMILES for [(3S)-5-ethoxycarbonyl-2,2,3-trimethyl-3H-furan-4-yl]boronic acid is CCOC(=O)C1=C(B(O)O)[C@H](C)C(C)(C)O1.
What is the InChIKey of [(3S)-5-ethoxycarbonyl-2,2,3-trimethyl-3H-furan-4-yl]boronic acid?
The InChIKey is GFYUXDSXTJCHFZ-LURJTMIESA-N. The full InChI is InChI=1S/C10H17BO5/c1-5-15-9(12)8-7(11(13)14)6(2)10(3,4)16-8/h6,13-14H,5H2,1-4H3/t6-/m0/s1.
What are the key properties of [(3S)-5-ethoxycarbonyl-2,2,3-trimethyl-3H-furan-4-yl]boronic acid?
[(3S)-5-ethoxycarbonyl-2,2,3-trimethyl-3H-furan-4-yl]boronic acid has a molecular weight of 228.05 g/mol, XLogP of 0.26, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-5-ethoxycarbonyl-2,2,3-trimethyl-3H-furan-4-yl]boronic acid is sourced from PubChem (CID 174151581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).