C10H17BO5 — CID 174151581
[(3S)-5-ethoxycarbonyl-2,2,3-trimethyl-3H-furan-4-yl]boronic acid (PubChem CID 174151581) has the molecular formula C10H17BO5 and a molecular weight of 228.05 g/mol. Its IUPAC name is [(3S)-5-ethoxycarbonyl-2,2,3-trimethyl-3H-furan-4-yl]boronic acid.
| Compound Name | [(3S)-5-ethoxycarbonyl-2,2,3-trimethyl-3H-furan-4-yl]boronic acid |
|---|---|
| PubChem CID | 174151581 |
| Molecular Formula | C10H17BO5 |
| Molecular Weight | 228.05 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | [(3S)-5-ethoxycarbonyl-2,2,3-trimethyl-3H-furan-4-yl]boronic acid |
| SMILES | CCOC(=O)C1=C(B(O)O)[C@H](C)C(C)(C)O1 |
| InChI | InChI=1S/C10H17BO5/c1-5-15-9(12)8-7(11(13)14)6(2)10(3,4)16-8/h6,13-14H,5H2,1-4H3/t6-/m0/s1 |
| InChIKey | GFYUXDSXTJCHFZ-LURJTMIESA-N |
| XLogP | 0.26 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.05 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|