C13H21IO3 — CID 11035552
ethyl 3-iodo-2,2-dimethyl-6-propan-2-yl-3,4-dihydropyran-5-carboxylate (PubChem CID 11035552) has the molecular formula C13H21IO3 and a molecular weight of 352.21 g/mol. Its IUPAC name is ethyl 3-iodo-2,2-dimethyl-6-propan-2-yl-3,4-dihydropyran-5-carboxylate.
| Compound Name | ethyl 3-iodo-2,2-dimethyl-6-propan-2-yl-3,4-dihydropyran-5-carboxylate |
|---|---|
| PubChem CID | 11035552 |
| Molecular Formula | C13H21IO3 |
| Molecular Weight | 352.21 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | ethyl 3-iodo-2,2-dimethyl-6-propan-2-yl-3,4-dihydropyran-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C(C)C)OC(C)(C)C(I)C1 |
| InChI | InChI=1S/C13H21IO3/c1-6-16-12(15)9-7-10(14)13(4,5)17-11(9)8(2)3/h8,10H,6-7H2,1-5H3 |
| InChIKey | CKHUCMAYGFKJDO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.21 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|