C18H23F3N4O5S — CID 139388580
tert-butyl 4-[7-(trifluoromethylsulfonyloxy)-5,6-dihydroquinazolin-4-yl]piperazine-1-carboxylate (PubChem CID 139388580) has the molecular formula C18H23F3N4O5S and a molecular weight of 464.47 g/mol. Its IUPAC name is tert-butyl 4-[7-(trifluoromethylsulfonyloxy)-5,6-dihydroquinazolin-4-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[7-(trifluoromethylsulfonyloxy)-5,6-dihydroquinazolin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 139388580 |
| Molecular Formula | C18H23F3N4O5S |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | tert-butyl 4-[7-(trifluoromethylsulfonyloxy)-5,6-dihydroquinazolin-4-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ncnc3c2CCC(OS(=O)(=O)C(F)(F)F)=C3)CC1 |
| InChI | InChI=1S/C18H23F3N4O5S/c1-17(2,3)29-16(26)25-8-6-24(7-9-25)15-13-5-4-12(10-14(13)22-11-23-15)30-31(27,28)18(19,20)21/h10-11H,4-9H2,1-3H3 |
| InChIKey | PIDGPNJDQJJNPP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 101.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|