C18H24N4O2 — CID 69365805
tert-butyl 4-quinazolin-4-yl-1,4-diazepane-1-carboxylate (PubChem CID 69365805) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is tert-butyl 4-quinazolin-4-yl-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl 4-quinazolin-4-yl-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 69365805 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | tert-butyl 4-quinazolin-4-yl-1,4-diazepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCN(c2ncnc3ccccc23)CC1 |
| InChI | InChI=1S/C18H24N4O2/c1-18(2,3)24-17(23)22-10-6-9-21(11-12-22)16-14-7-4-5-8-15(14)19-13-20-16/h4-5,7-8,13H,6,9-12H2,1-3H3 |
| InChIKey | RUVWUWPAVSDAQQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |