C27H33N5O3 — CID 67539056
tert-butyl 2-amino-3-(4-methylphenyl)-4-oxo-4-(4-quinazolin-4-ylpiperazin-1-yl)butanoate (PubChem CID 67539056) has the molecular formula C27H33N5O3 and a molecular weight of 475.59 g/mol. Its IUPAC name is tert-butyl 2-amino-3-(4-methylphenyl)-4-oxo-4-(4-quinazolin-4-ylpiperazin-1-yl)butanoate.
| Compound Name | tert-butyl 2-amino-3-(4-methylphenyl)-4-oxo-4-(4-quinazolin-4-ylpiperazin-1-yl)butanoate |
|---|---|
| PubChem CID | 67539056 |
| Molecular Formula | C27H33N5O3 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | tert-butyl 2-amino-3-(4-methylphenyl)-4-oxo-4-(4-quinazolin-4-ylpiperazin-1-yl)butanoate |
| SMILES | Cc1ccc(C(C(=O)N2CCN(c3ncnc4ccccc34)CC2)C(N)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C27H33N5O3/c1-18-9-11-19(12-10-18)22(23(28)26(34)35-27(2,3)4)25(33)32-15-13-31(14-16-32)24-20-7-5-6-8-21(20)29-17-30-24/h5-12,17,22-23H,13-16,28H2,1-4H3 |
| InChIKey | YSJYCOIYQORBCB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |