C18H24N4O — CID 171335913
2,2-dimethyl-1-(4-quinazolin-4-yl-1,4-diazepan-1-yl)propan-1-one (PubChem CID 171335913) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is 2,2-dimethyl-1-(4-quinazolin-4-yl-1,4-diazepan-1-yl)propan-1-one.
| Compound Name | 2,2-dimethyl-1-(4-quinazolin-4-yl-1,4-diazepan-1-yl)propan-1-one |
|---|---|
| PubChem CID | 171335913 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 2,2-dimethyl-1-(4-quinazolin-4-yl-1,4-diazepan-1-yl)propan-1-one |
| SMILES | CC(C)(C)C(=O)N1CCCN(c2ncnc3ccccc23)CC1 |
| InChI | InChI=1S/C18H24N4O/c1-18(2,3)17(23)22-10-6-9-21(11-12-22)16-14-7-4-5-8-15(14)19-13-20-16/h4-5,7-8,13H,6,9-12H2,1-3H3 |
| InChIKey | ZENVZWXCOVNSOT-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |