C14H16N4O2 — CID 178170042
1-methyl-4-quinazolin-4-ylpiperazine-2-carboxylic acid (PubChem CID 178170042) has the molecular formula C14H16N4O2 and a molecular weight of 272.31 g/mol. Its IUPAC name is 1-methyl-4-quinazolin-4-ylpiperazine-2-carboxylic acid.
| Compound Name | 1-methyl-4-quinazolin-4-ylpiperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 178170042 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 1-methyl-4-quinazolin-4-ylpiperazine-2-carboxylic acid |
| SMILES | CN1CCN(c2ncnc3ccccc23)CC1C(=O)O |
| InChI | InChI=1S/C14H16N4O2/c1-17-6-7-18(8-12(17)14(19)20)13-10-4-2-3-5-11(10)15-9-16-13/h2-5,9,12H,6-8H2,1H3,(H,19,20) |
| InChIKey | PYSOPHPDVOGZGK-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |