C16H14F17NO2 — CID 130427251
4-[1,2,3,3,3-pentafluoro-2-[5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-yl]propyl]-2,6-bis(trifluoromethyl)morpholine (PubChem CID 130427251) has the molecular formula C16H14F17NO2 and a molecular weight of 575.26 g/mol. Its IUPAC name is 4-[1,2,3,3,3-pentafluoro-2-[5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-yl]propyl]-2,6-bis(trifluoromethyl)morpholine.
| Compound Name | 4-[1,2,3,3,3-pentafluoro-2-[5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-yl]propyl]-2,6-bis(trifluoromethyl)morpholine |
|---|---|
| PubChem CID | 130427251 |
| Molecular Formula | C16H14F17NO2 |
| Molecular Weight | 575.26 g/mol |
| Exact Mass | 575.08 |
| IUPAC Name | 4-[1,2,3,3,3-pentafluoro-2-[5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-yl]propyl]-2,6-bis(trifluoromethyl)morpholine |
| SMILES | FC(C(F)(F)F)C(F)(F)C1CCC(C(F)(C(F)N2CC(C(F)(F)F)OC(C(F)(F)F)C2)C(F)(F)F)O1 |
| InChI | InChI=1S/C16H14F17NO2/c17-9(15(28,29)30)12(20,21)6-2-1-5(35-6)11(19,16(31,32)33)10(18)34-3-7(13(22,23)24)36-8(4-34)14(25,26)27/h5-10H,1-4H2 |
| InChIKey | MENHPYXQRVYMEJ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.26 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|