C9H8F11NO — CID 162606326
4-(1,2,3,3,3-pentafluoropropyl)-2,6-bis(trifluoromethyl)morpholine (PubChem CID 162606326) has the molecular formula C9H8F11NO and a molecular weight of 355.15 g/mol. Its IUPAC name is 4-(1,2,3,3,3-pentafluoropropyl)-2,6-bis(trifluoromethyl)morpholine.
| Compound Name | 4-(1,2,3,3,3-pentafluoropropyl)-2,6-bis(trifluoromethyl)morpholine |
|---|---|
| PubChem CID | 162606326 |
| Molecular Formula | C9H8F11NO |
| Molecular Weight | 355.15 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 4-(1,2,3,3,3-pentafluoropropyl)-2,6-bis(trifluoromethyl)morpholine |
| SMILES | FC(C(F)C(F)(F)F)N1CC(C(F)(F)F)OC(C(F)(F)F)C1 |
| InChI | InChI=1S/C9H8F11NO/c10-5(9(18,19)20)6(11)21-1-3(7(12,13)14)22-4(2-21)8(15,16)17/h3-6H,1-2H2 |
| InChIKey | SFMCEEJUIPTZPS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.15 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|