C10H10F6 — CID 152653789
5-(1,1,2,3,3,3-hexafluoropropyl)bicyclo[2.2.1]hept-2-ene (PubChem CID 152653789) has the molecular formula C10H10F6 and a molecular weight of 244.18 g/mol. Its IUPAC name is 5-(1,1,2,3,3,3-hexafluoropropyl)bicyclo[2.2.1]hept-2-ene.
| Compound Name | 5-(1,1,2,3,3,3-hexafluoropropyl)bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 152653789 |
| Molecular Formula | C10H10F6 |
| Molecular Weight | 244.18 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 5-(1,1,2,3,3,3-hexafluoropropyl)bicyclo[2.2.1]hept-2-ene |
| SMILES | FC(C(F)(F)F)C(F)(F)C1CC2C=CC1C2 |
| InChI | InChI=1S/C10H10F6/c11-8(10(14,15)16)9(12,13)7-4-5-1-2-6(7)3-5/h1-2,5-8H,3-4H2 |
| InChIKey | ZICGLADFNADWRQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.18 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|