About bicyclo[2.2.1]hept-2-ene;fluoroform;sulfane
bicyclo[2.2.1]hept-2-ene;fluoroform;sulfane (PubChem CID 174548915) has the molecular formula C8H13F3S
and a molecular weight of 198.25 g/mol. Its IUPAC name is bicyclo[2.2.1]hept-2-ene;fluoroform;sulfane.
Molecular Properties
| Compound Name | bicyclo[2.2.1]hept-2-ene;fluoroform;sulfane |
| PubChem CID | 174548915 |
| Molecular Formula | C8H13F3S |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | bicyclo[2.2.1]hept-2-ene;fluoroform;sulfane |
| SMILES | C1=CC2CCC1C2.FC(F)F.S |
| InChI | InChI=1S/C7H10.CHF3.H2S/c1-2-7-4-3-6(1)5-7;2-1(3)4;/h1-2,6-7H,3-5H2;1H;1H2 |
| InChIKey | UJUCOASHMPIAPN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.1]hept-2-ene;fluoroform;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]hept-2-ene;fluoroform;sulfane?
The IUPAC name of bicyclo[2.2.1]hept-2-ene;fluoroform;sulfane (CID 174548915) is bicyclo[2.2.1]hept-2-ene;fluoroform;sulfane.
What is the SMILES notation for bicyclo[2.2.1]hept-2-ene;fluoroform;sulfane?
The canonical SMILES for bicyclo[2.2.1]hept-2-ene;fluoroform;sulfane is C1=CC2CCC1C2.FC(F)F.S.
What is the InChIKey of bicyclo[2.2.1]hept-2-ene;fluoroform;sulfane?
The InChIKey is UJUCOASHMPIAPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10.CHF3.H2S/c1-2-7-4-3-6(1)5-7;2-1(3)4;/h1-2,6-7H,3-5H2;1H;1H2.
What are the key properties of bicyclo[2.2.1]hept-2-ene;fluoroform;sulfane?
bicyclo[2.2.1]hept-2-ene;fluoroform;sulfane has a molecular weight of 198.25 g/mol, XLogP of 3.26, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]hept-2-ene;fluoroform;sulfane is sourced from PubChem (CID 174548915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).