C11H14F6O — CID 87422539
bicyclo[2.2.1]hept-2-ene;1,1,1,3,3,3-hexafluoro-2-methylpropan-2-ol (PubChem CID 87422539) has the molecular formula C11H14F6O and a molecular weight of 276.22 g/mol. Its IUPAC name is bicyclo[2.2.1]hept-2-ene;1,1,1,3,3,3-hexafluoro-2-methylpropan-2-ol.
| Compound Name | bicyclo[2.2.1]hept-2-ene;1,1,1,3,3,3-hexafluoro-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 87422539 |
| Molecular Formula | C11H14F6O |
| Molecular Weight | 276.22 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | bicyclo[2.2.1]hept-2-ene;1,1,1,3,3,3-hexafluoro-2-methylpropan-2-ol |
| SMILES | C1=CC2CCC1C2.CC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H10.C4H4F6O/c1-2-7-4-3-6(1)5-7;1-2(11,3(5,6)7)4(8,9)10/h1-2,6-7H,3-5H2;11H,1H3 |
| InChIKey | LHUDZAVRCXOPBK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.22 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|