C12H18 — CID 175010538
bicyclo[2.2.1]hept-2-ene;2-methylbuta-1,3-diene (PubChem CID 175010538) has the molecular formula C12H18 and a molecular weight of 162.28 g/mol. Its IUPAC name is bicyclo[2.2.1]hept-2-ene;2-methylbuta-1,3-diene.
| Compound Name | bicyclo[2.2.1]hept-2-ene;2-methylbuta-1,3-diene |
|---|---|
| PubChem CID | 175010538 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | bicyclo[2.2.1]hept-2-ene;2-methylbuta-1,3-diene |
| SMILES | C1=CC2CCC1C2.C=CC(=C)C |
| InChI | InChI=1S/C7H10.C5H8/c1-2-7-4-3-6(1)5-7;1-4-5(2)3/h1-2,6-7H,3-5H2;4H,1-2H2,3H3 |
| InChIKey | JVQOPEAHKGMKTK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|