About bicyclo[2.2.1]hept-2-ene;trichlororhodium
bicyclo[2.2.1]hept-2-ene;trichlororhodium (PubChem CID 175974959) has the molecular formula C7H10Cl3Rh
and a molecular weight of 303.42 g/mol. Its IUPAC name is bicyclo[2.2.1]hept-2-ene;trichlororhodium.
Molecular Properties
| Compound Name | bicyclo[2.2.1]hept-2-ene;trichlororhodium |
| PubChem CID | 175974959 |
| Molecular Formula | C7H10Cl3Rh |
| Molecular Weight | 303.42 g/mol |
| Exact Mass | 301.89 |
| IUPAC Name | bicyclo[2.2.1]hept-2-ene;trichlororhodium |
| SMILES | C1=CC2CCC1C2.Cl[Rh](Cl)Cl |
| InChI | InChI=1S/C7H10.3ClH.Rh/c1-2-7-4-3-6(1)5-7;;;;/h1-2,6-7H,3-5H2;3*1H;/q;;;;+3/p-3 |
| InChIKey | BTNPCIVTSPWXMK-UHFFFAOYSA-K |
| XLogP | 4.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.1]hept-2-ene;trichlororhodium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]hept-2-ene;trichlororhodium?
The IUPAC name of bicyclo[2.2.1]hept-2-ene;trichlororhodium (CID 175974959) is bicyclo[2.2.1]hept-2-ene;trichlororhodium.
What is the SMILES notation for bicyclo[2.2.1]hept-2-ene;trichlororhodium?
The canonical SMILES for bicyclo[2.2.1]hept-2-ene;trichlororhodium is C1=CC2CCC1C2.Cl[Rh](Cl)Cl.
What is the InChIKey of bicyclo[2.2.1]hept-2-ene;trichlororhodium?
The InChIKey is BTNPCIVTSPWXMK-UHFFFAOYSA-K. The full InChI is InChI=1S/C7H10.3ClH.Rh/c1-2-7-4-3-6(1)5-7;;;;/h1-2,6-7H,3-5H2;3*1H;/q;;;;+3/p-3.
What are the key properties of bicyclo[2.2.1]hept-2-ene;trichlororhodium?
bicyclo[2.2.1]hept-2-ene;trichlororhodium has a molecular weight of 303.42 g/mol, XLogP of 4.04, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]hept-2-ene;trichlororhodium is sourced from PubChem (CID 175974959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).