C22H28 — CID 173404323
bicyclo[2.2.1]hept-2-ene;tris(cyclopenta-1,3-diene) (PubChem CID 173404323) has the molecular formula C22H28 and a molecular weight of 292.47 g/mol. Its IUPAC name is bicyclo[2.2.1]hept-2-ene;tris(cyclopenta-1,3-diene).
| Compound Name | bicyclo[2.2.1]hept-2-ene;tris(cyclopenta-1,3-diene) |
|---|---|
| PubChem CID | 173404323 |
| Molecular Formula | C22H28 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | bicyclo[2.2.1]hept-2-ene;tris(cyclopenta-1,3-diene) |
| SMILES | C1=CC2CCC1C2.C1=CCC=C1.C1=CCC=C1.C1=CCC=C1 |
| InChI | InChI=1S/C7H10.3C5H6/c1-2-7-4-3-6(1)5-7;3*1-2-4-5-3-1/h1-2,6-7H,3-5H2;3*1-4H,5H2 |
| InChIKey | JAELHHPHFXPYGD-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|