About 2-aminopropanoic acid;bicyclo[2.2.1]hept-2-ene
2-aminopropanoic acid;bicyclo[2.2.1]hept-2-ene (PubChem CID 137424386) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is 2-aminopropanoic acid;bicyclo[2.2.1]hept-2-ene.
Molecular Properties
| Compound Name | 2-aminopropanoic acid;bicyclo[2.2.1]hept-2-ene |
| PubChem CID | 137424386 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 2-aminopropanoic acid;bicyclo[2.2.1]hept-2-ene |
| SMILES | C1=CC2CCC1C2.CC(N)C(=O)O |
| InChI | InChI=1S/C7H10.C3H7NO2/c1-2-7-4-3-6(1)5-7;1-2(4)3(5)6/h1-2,6-7H,3-5H2;2H,4H2,1H3,(H,5,6) |
| InChIKey | PMXRFVXNWLAFBC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-aminopropanoic acid;bicyclo[2.2.1]hept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminopropanoic acid;bicyclo[2.2.1]hept-2-ene?
The IUPAC name of 2-aminopropanoic acid;bicyclo[2.2.1]hept-2-ene (CID 137424386) is 2-aminopropanoic acid;bicyclo[2.2.1]hept-2-ene.
What is the SMILES notation for 2-aminopropanoic acid;bicyclo[2.2.1]hept-2-ene?
The canonical SMILES for 2-aminopropanoic acid;bicyclo[2.2.1]hept-2-ene is C1=CC2CCC1C2.CC(N)C(=O)O.
What is the InChIKey of 2-aminopropanoic acid;bicyclo[2.2.1]hept-2-ene?
The InChIKey is PMXRFVXNWLAFBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10.C3H7NO2/c1-2-7-4-3-6(1)5-7;1-2(4)3(5)6/h1-2,6-7H,3-5H2;2H,4H2,1H3,(H,5,6).
What are the key properties of 2-aminopropanoic acid;bicyclo[2.2.1]hept-2-ene?
2-aminopropanoic acid;bicyclo[2.2.1]hept-2-ene has a molecular weight of 183.25 g/mol, XLogP of 1.39, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminopropanoic acid;bicyclo[2.2.1]hept-2-ene is sourced from PubChem (CID 137424386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).