C13H23NO2 — CID 137424283
2-amino-4-methylpentanoic acid;bicyclo[2.2.1]hept-2-ene (PubChem CID 137424283) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is 2-amino-4-methylpentanoic acid;bicyclo[2.2.1]hept-2-ene.
| Compound Name | 2-amino-4-methylpentanoic acid;bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 137424283 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 2-amino-4-methylpentanoic acid;bicyclo[2.2.1]hept-2-ene |
| SMILES | C1=CC2CCC1C2.CC(C)CC(N)C(=O)O |
| InChI | InChI=1S/C7H10.C6H13NO2/c1-2-7-4-3-6(1)5-7;1-4(2)3-5(7)6(8)9/h1-2,6-7H,3-5H2;4-5H,3,7H2,1-2H3,(H,8,9) |
| InChIKey | SSOBREQQDXNQPP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|