C9H14Cl2Si — CID 123708298
[2-(2-bicyclo[2.2.1]hept-5-enyl)-2,2-dichloroethyl]silane (PubChem CID 123708298) has the molecular formula C9H14Cl2Si and a molecular weight of 221.20 g/mol. Its IUPAC name is [2-(2-bicyclo[2.2.1]hept-5-enyl)-2,2-dichloroethyl]silane.
| Compound Name | [2-(2-bicyclo[2.2.1]hept-5-enyl)-2,2-dichloroethyl]silane |
|---|---|
| PubChem CID | 123708298 |
| Molecular Formula | C9H14Cl2Si |
| Molecular Weight | 221.20 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | [2-(2-bicyclo[2.2.1]hept-5-enyl)-2,2-dichloroethyl]silane |
| SMILES | [SiH3]CC(Cl)(Cl)C1CC2C=CC1C2 |
| InChI | InChI=1S/C9H14Cl2Si/c10-9(11,5-12)8-4-6-1-2-7(8)3-6/h1-2,6-8H,3-5H2,12H3 |
| InChIKey | RYSQUSRJJKPQPC-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.20 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|