C10H12Cl4 — CID 101408843
5-(1,3,3,3-tetrachloropropyl)bicyclo[2.2.1]hept-2-ene (PubChem CID 101408843) has the molecular formula C10H12Cl4 and a molecular weight of 274.02 g/mol. Its IUPAC name is 5-(1,3,3,3-tetrachloropropyl)bicyclo[2.2.1]hept-2-ene.
| Compound Name | 5-(1,3,3,3-tetrachloropropyl)bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 101408843 |
| Molecular Formula | C10H12Cl4 |
| Molecular Weight | 274.02 g/mol |
| Exact Mass | 271.97 |
| IUPAC Name | 5-(1,3,3,3-tetrachloropropyl)bicyclo[2.2.1]hept-2-ene |
| SMILES | ClC(CC(Cl)(Cl)Cl)C1CC2C=CC1C2 |
| InChI | InChI=1S/C10H12Cl4/c11-9(5-10(12,13)14)8-4-6-1-2-7(8)3-6/h1-2,6-9H,3-5H2 |
| InChIKey | SFMHDHMPNDDXHC-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.02 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|