C15H25NO2 — CID 81462502
tert-butyl 2-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethylamino]acetate (PubChem CID 81462502) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is tert-butyl 2-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethylamino]acetate.
| Compound Name | tert-butyl 2-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethylamino]acetate |
|---|---|
| PubChem CID | 81462502 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | tert-butyl 2-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethylamino]acetate |
| SMILES | CC(NCC(=O)OC(C)(C)C)C1CC2C=CC1C2 |
| InChI | InChI=1S/C15H25NO2/c1-10(13-8-11-5-6-12(13)7-11)16-9-14(17)18-15(2,3)4/h5-6,10-13,16H,7-9H2,1-4H3 |
| InChIKey | KXQLSLQHGGZXGP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|