C13H21N — CID 114615642
N-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethyl]-2-methylprop-2-en-1-amine (PubChem CID 114615642) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is N-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethyl]-2-methylprop-2-en-1-amine.
| Compound Name | N-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethyl]-2-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 114615642 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | N-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethyl]-2-methylprop-2-en-1-amine |
| SMILES | C=C(C)CNC(C)C1CC2C=CC1C2 |
| InChI | InChI=1S/C13H21N/c1-9(2)8-14-10(3)13-7-11-4-5-12(13)6-11/h4-5,10-14H,1,6-8H2,2-3H3 |
| InChIKey | QDNHZTFUPDWBMR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|